About 5-iodopentanoyl chloride
5-iodopentanoyl chloride (PubChem CID 15337131) has the molecular formula C5H8ClIO
and a molecular weight of 246.47 g/mol. Its IUPAC name is 5-iodopentanoyl chloride.
Molecular Properties
| Compound Name | 5-iodopentanoyl chloride |
| PubChem CID | 15337131 |
| Molecular Formula | C5H8ClIO |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | 5-iodopentanoyl chloride |
| SMILES | O=C(Cl)CCCCI |
| InChI | InChI=1S/C5H8ClIO/c6-5(8)3-1-2-4-7/h1-4H2 |
| InChIKey | RHTNOPRQXJRZPE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodopentanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodopentanoyl chloride?
The IUPAC name of 5-iodopentanoyl chloride (CID 15337131) is 5-iodopentanoyl chloride.
What is the SMILES notation for 5-iodopentanoyl chloride?
The canonical SMILES for 5-iodopentanoyl chloride is O=C(Cl)CCCCI.
What is the InChIKey of 5-iodopentanoyl chloride?
The InChIKey is RHTNOPRQXJRZPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClIO/c6-5(8)3-1-2-4-7/h1-4H2.
What are the key properties of 5-iodopentanoyl chloride?
5-iodopentanoyl chloride has a molecular weight of 246.47 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodopentanoyl chloride is sourced from PubChem (CID 15337131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).