C32H46FN3O6 — CID 153371643
[(2S,3S,4E,6R,7S)-2-[(E)-1-(3-fluoro-5-morpholin-4-ylphenyl)prop-1-en-2-yl]-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-methylpiperazine-1-carboxylate (PubChem CID 153371643) has the molecular formula C32H46FN3O6 and a molecular weight of 587.73 g/mol. Its IUPAC name is [(2S,3S,4E,6R,7S)-2-[(E)-1-(3-fluoro-5-morpholin-4-ylphenyl)prop-1-en-2-yl]-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [(2S,3S,4E,6R,7S)-2-[(E)-1-(3-fluoro-5-morpholin-4-ylphenyl)prop-1-en-2-yl]-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 153371643 |
| Molecular Formula | C32H46FN3O6 |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.34 |
| IUPAC Name | [(2S,3S,4E,6R,7S)-2-[(E)-1-(3-fluoro-5-morpholin-4-ylphenyl)prop-1-en-2-yl]-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-methylpiperazine-1-carboxylate |
| SMILES | C/C(=C\c1cc(F)cc(N2CCOCC2)c1)[C@H]1OC(=O)CC(O)CC[C@H](C)[C@@H](OC(=O)N2CCN(C)CC2)/C=C/[C@@H]1C |
| InChI | InChI=1S/C32H46FN3O6/c1-22-5-7-28(37)21-30(38)42-31(23(2)6-8-29(22)41-32(39)36-11-9-34(4)10-12-36)24(3)17-25-18-26(33)20-27(19-25)35-13-15-40-16-14-35/h6,8,17-20,22-23,28-29,31,37H,5,7,9-16,21H2,1-4H3/b8-6+,24-17+/t22-,23-,28?,29-,31-/m0/s1 |
| InChIKey | KZPDDZTYZGFWDH-QLNRLKHKSA-N |
| XLogP | 4.10 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|