C29H43N3O5 — CID 153371705
[(2S,3S,4Z,6R,7S,10R)-2-[(E)-1-[3-(dimethylamino)phenyl]prop-1-en-2-yl]-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] piperazine-1-carboxylate (PubChem CID 153371705) has the molecular formula C29H43N3O5 and a molecular weight of 513.68 g/mol. Its IUPAC name is [(2S,3S,4Z,6R,7S,10R)-2-[(E)-1-[3-(dimethylamino)phenyl]prop-1-en-2-yl]-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] piperazine-1-carboxylate.
| Compound Name | [(2S,3S,4Z,6R,7S,10R)-2-[(E)-1-[3-(dimethylamino)phenyl]prop-1-en-2-yl]-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 153371705 |
| Molecular Formula | C29H43N3O5 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | [(2S,3S,4Z,6R,7S,10R)-2-[(E)-1-[3-(dimethylamino)phenyl]prop-1-en-2-yl]-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] piperazine-1-carboxylate |
| SMILES | C/C(=C\c1cccc(N(C)C)c1)[C@H]1OC(=O)C[C@H](O)CC[C@H](C)[C@@H](OC(=O)N2CCNCC2)/C=C\[C@@H]1C |
| InChI | InChI=1S/C29H43N3O5/c1-20-9-11-25(33)19-27(34)37-28(22(3)17-23-7-6-8-24(18-23)31(4)5)21(2)10-12-26(20)36-29(35)32-15-13-30-14-16-32/h6-8,10,12,17-18,20-21,25-26,28,30,33H,9,11,13-16,19H2,1-5H3/b12-10-,22-17+/t20-,21-,25+,26-,28-/m0/s1 |
| InChIKey | CXLDODFHTZPDHA-OKYMDCCFSA-N |
| XLogP | 3.85 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|