About 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol
3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol (PubChem CID 153372112) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol.
Molecular Properties
| Compound Name | 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol |
| PubChem CID | 153372112 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol |
| SMILES | CC(C)(C)c1cc(N)c(N)c(=O)[nH]1.CO |
| InChI | InChI=1S/C9H15N3O.CH4O/c1-9(2,3)6-4-5(10)7(11)8(13)12-6;1-2/h4H,11H2,1-3H3,(H3,10,12,13);2H,1H3 |
| InChIKey | COXIKDQXSJZFFP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol?
The IUPAC name of 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol (CID 153372112) is 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol.
What is the SMILES notation for 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol?
The canonical SMILES for 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol is CC(C)(C)c1cc(N)c(N)c(=O)[nH]1.CO.
What is the InChIKey of 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol?
The InChIKey is COXIKDQXSJZFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O.CH4O/c1-9(2,3)6-4-5(10)7(11)8(13)12-6;1-2/h4H,11H2,1-3H3,(H3,10,12,13);2H,1H3.
What are the key properties of 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol?
3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol has a molecular weight of 213.28 g/mol, XLogP of 0.45, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-6-tert-butyl-1H-pyridin-2-one;methanol is sourced from PubChem (CID 153372112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).