C13H14BrNO2 — CID 153372261
(Z)-N-(4-bromophenyl)-N,2,3-trimethyl-4-oxobut-2-enamide (PubChem CID 153372261) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is (Z)-N-(4-bromophenyl)-N,2,3-trimethyl-4-oxobut-2-enamide.
| Compound Name | (Z)-N-(4-bromophenyl)-N,2,3-trimethyl-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 153372261 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | (Z)-N-(4-bromophenyl)-N,2,3-trimethyl-4-oxobut-2-enamide |
| SMILES | C/C(C=O)=C(\C)C(=O)N(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14BrNO2/c1-9(8-16)10(2)13(17)15(3)12-6-4-11(14)5-7-12/h4-8H,1-3H3/b10-9- |
| InChIKey | ZGUPAZGCQCWTKT-KTKRTIGZSA-N |
| XLogP | 2.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|