C13H18ClFNO- — CID 153372396
[(2R)-5-(3-chloro-4-fluoro-5-methylphenyl)-1-methoxypentan-2-yl]azanide (PubChem CID 153372396) has the molecular formula C13H18ClFNO- and a molecular weight of 258.74 g/mol. Its IUPAC name is [(2R)-5-(3-chloro-4-fluoro-5-methylphenyl)-1-methoxypentan-2-yl]azanide.
| Compound Name | [(2R)-5-(3-chloro-4-fluoro-5-methylphenyl)-1-methoxypentan-2-yl]azanide |
|---|---|
| PubChem CID | 153372396 |
| Molecular Formula | C13H18ClFNO- |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | [(2R)-5-(3-chloro-4-fluoro-5-methylphenyl)-1-methoxypentan-2-yl]azanide |
| SMILES | COC[C@H]([NH-])CCCc1cc(C)c(F)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClFNO/c1-9-6-10(7-12(14)13(9)15)4-3-5-11(16)8-17-2/h6-7,11,16H,3-5,8H2,1-2H3/q-1/t11-/m1/s1 |
| InChIKey | SOPQSQNXHOIEPS-LLVKDONJSA-N |
| XLogP | 4.18 |
| TPSA | 33.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |