C20H23NO2 — CID 153372613
tert-butyl 3-(2-phenylphenyl)azetidine-1-carboxylate (PubChem CID 153372613) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl 3-(2-phenylphenyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-phenylphenyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 153372613 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl 3-(2-phenylphenyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccccc2-c2ccccc2)C1 |
| InChI | InChI=1S/C20H23NO2/c1-20(2,3)23-19(22)21-13-16(14-21)18-12-8-7-11-17(18)15-9-5-4-6-10-15/h4-12,16H,13-14H2,1-3H3 |
| InChIKey | URPQXPVZJXDDNN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |