About [(2R,4S)-2-methoxyoxan-4-yl] acetate
[(2R,4S)-2-methoxyoxan-4-yl] acetate (PubChem CID 153373300) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is [(2R,4S)-2-methoxyoxan-4-yl] acetate.
Molecular Properties
| Compound Name | [(2R,4S)-2-methoxyoxan-4-yl] acetate |
| PubChem CID | 153373300 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | [(2R,4S)-2-methoxyoxan-4-yl] acetate |
| SMILES | CO[C@H]1C[C@@H](OC(C)=O)CCO1 |
| InChI | InChI=1S/C8H14O4/c1-6(9)12-7-3-4-11-8(5-7)10-2/h7-8H,3-5H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | XCAYCLBKXTZEDQ-JGVFFNPUSA-N |
| XLogP | 0.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R,4S)-2-methoxyoxan-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-2-methoxyoxan-4-yl] acetate?
The IUPAC name of [(2R,4S)-2-methoxyoxan-4-yl] acetate (CID 153373300) is [(2R,4S)-2-methoxyoxan-4-yl] acetate.
What is the SMILES notation for [(2R,4S)-2-methoxyoxan-4-yl] acetate?
The canonical SMILES for [(2R,4S)-2-methoxyoxan-4-yl] acetate is CO[C@H]1C[C@@H](OC(C)=O)CCO1.
What is the InChIKey of [(2R,4S)-2-methoxyoxan-4-yl] acetate?
The InChIKey is XCAYCLBKXTZEDQ-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H14O4/c1-6(9)12-7-3-4-11-8(5-7)10-2/h7-8H,3-5H2,1-2H3/t7-,8+/m0/s1.
What are the key properties of [(2R,4S)-2-methoxyoxan-4-yl] acetate?
[(2R,4S)-2-methoxyoxan-4-yl] acetate has a molecular weight of 174.20 g/mol, XLogP of 0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-2-methoxyoxan-4-yl] acetate is sourced from PubChem (CID 153373300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).