About (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate
(Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate (PubChem CID 153373433) has the molecular formula C13H18N2O6
and a molecular weight of 298.29 g/mol. Its IUPAC name is (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate.
Molecular Properties
| Compound Name | (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate |
| PubChem CID | 153373433 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate |
| SMILES | CN(C)CCC(=O)ON1C(=O)CCC1=O.O=C/C=C\C=O |
| InChI | InChI=1S/C9H14N2O4.C4H4O2/c1-10(2)6-5-9(14)15-11-7(12)3-4-8(11)13;5-3-1-2-4-6/h3-6H2,1-2H3;1-4H/b;2-1- |
| InChIKey | DVROIASZLPORPG-BTJKTKAUSA-N |
| XLogP | -0.51 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate?
The IUPAC name of (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate (CID 153373433) is (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate.
What is the SMILES notation for (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate?
The canonical SMILES for (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate is CN(C)CCC(=O)ON1C(=O)CCC1=O.O=C/C=C\C=O.
What is the InChIKey of (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate?
The InChIKey is DVROIASZLPORPG-BTJKTKAUSA-N. The full InChI is InChI=1S/C9H14N2O4.C4H4O2/c1-10(2)6-5-9(14)15-11-7(12)3-4-8(11)13;5-3-1-2-4-6/h3-6H2,1-2H3;1-4H/b;2-1-.
What are the key properties of (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate?
(Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate has a molecular weight of 298.29 g/mol, XLogP of -0.51, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedial;(2,5-dioxopyrrolidin-1-yl) 3-(dimethylamino)propanoate is sourced from PubChem (CID 153373433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).