About 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate
3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate (PubChem CID 153373502) has the molecular formula C8H8ClNO4
and a molecular weight of 217.61 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate |
| PubChem CID | 153373502 |
| Molecular Formula | C8H8ClNO4 |
| Molecular Weight | 217.61 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate |
| SMILES | O=C(Cl)OCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H8ClNO4/c9-8(13)14-5-1-4-10-6(11)2-3-7(10)12/h2-3H,1,4-5H2 |
| InChIKey | PALXZXMDRDUQQL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.61 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate (CID 153373502) is 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate is O=C(Cl)OCCCN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate?
The InChIKey is PALXZXMDRDUQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO4/c9-8(13)14-5-1-4-10-6(11)2-3-7(10)12/h2-3H,1,4-5H2.
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate?
3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate has a molecular weight of 217.61 g/mol, XLogP of 0.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)propyl carbonochloridate is sourced from PubChem (CID 153373502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).