C30H30FN7O — CID 153373542
(6R,11Z)-11-[anilino-[[4-(6-fluoro-2-pyridinyl)phenyl]methylamino]methylidene]-12-imino-2,9-dimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodec-7-en-10-one (PubChem CID 153373542) has the molecular formula C30H30FN7O and a molecular weight of 523.62 g/mol. Its IUPAC name is (6R,11Z)-11-[anilino-[[4-(6-fluoro-2-pyridinyl)phenyl]methylamino]methylidene]-12-imino-2,9-dimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodec-7-en-10-one.
| Compound Name | (6R,11Z)-11-[anilino-[[4-(6-fluoro-2-pyridinyl)phenyl]methylamino]methylidene]-12-imino-2,9-dimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodec-7-en-10-one |
|---|---|
| PubChem CID | 153373542 |
| Molecular Formula | C30H30FN7O |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | (6R,11Z)-11-[anilino-[[4-(6-fluoro-2-pyridinyl)phenyl]methylamino]methylidene]-12-imino-2,9-dimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodec-7-en-10-one |
| SMILES | [H]/N=c1\c(=C(/NCc2ccc(-c3cccc(F)n3)cc2)Nc2ccccc2)c(=O)n(C)c2n1C1(C)CCC[C@H]1N=2 |
| InChI | InChI=1S/C30H30FN7O/c1-30-17-7-11-23(30)36-29-37(2)28(39)25(26(32)38(29)30)27(34-21-8-4-3-5-9-21)33-18-19-13-15-20(16-14-19)22-10-6-12-24(31)35-22/h3-6,8-10,12-16,23,32-34H,7,11,17-18H2,1-2H3/b27-25-,32-26+/t23-,30?/m1/s1 |
| InChIKey | MFPIWJUCCYKWQT-ZVSGIYJPSA-N |
| XLogP | 2.74 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|