C20H24Cl3F4N3O — CID 153374446
3,5-dichloro-4-[6-chloro-4-(3,3-difluorocyclobutyl)pyridazin-3-yl]oxyaniline;2,2-difluorobutane;ethane (PubChem CID 153374446) has the molecular formula C20H24Cl3F4N3O and a molecular weight of 504.78 g/mol. Its IUPAC name is 3,5-dichloro-4-[6-chloro-4-(3,3-difluorocyclobutyl)pyridazin-3-yl]oxyaniline;2,2-difluorobutane;ethane.
| Compound Name | 3,5-dichloro-4-[6-chloro-4-(3,3-difluorocyclobutyl)pyridazin-3-yl]oxyaniline;2,2-difluorobutane;ethane |
|---|---|
| PubChem CID | 153374446 |
| Molecular Formula | C20H24Cl3F4N3O |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 3,5-dichloro-4-[6-chloro-4-(3,3-difluorocyclobutyl)pyridazin-3-yl]oxyaniline;2,2-difluorobutane;ethane |
| SMILES | CC.CCC(C)(F)F.Nc1cc(Cl)c(Oc2nnc(Cl)cc2C2CC(F)(F)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl3F2N3O.C4H8F2.C2H6/c15-9-1-7(20)2-10(16)12(9)23-13-8(3-11(17)21-22-13)6-4-14(18,19)5-6;1-3-4(2,5)6;1-2/h1-3,6H,4-5,20H2;3H2,1-2H3;1-2H3 |
| InChIKey | PMPDJFCBROAPCX-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|