About 2-ethylquinazoline;hydrochloride
2-ethylquinazoline;hydrochloride (PubChem CID 153374561) has the molecular formula C10H11ClN2
and a molecular weight of 194.67 g/mol. Its IUPAC name is 2-ethylquinazoline;hydrochloride.
Molecular Properties
| Compound Name | 2-ethylquinazoline;hydrochloride |
| PubChem CID | 153374561 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.67 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-ethylquinazoline;hydrochloride |
| SMILES | CCc1ncc2ccccc2n1.Cl |
| InChI | InChI=1S/C10H10N2.ClH/c1-2-10-11-7-8-5-3-4-6-9(8)12-10;/h3-7H,2H2,1H3;1H |
| InChIKey | YGHRDFJIWYCDIR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.67 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylquinazoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylquinazoline;hydrochloride?
The IUPAC name of 2-ethylquinazoline;hydrochloride (CID 153374561) is 2-ethylquinazoline;hydrochloride.
What is the SMILES notation for 2-ethylquinazoline;hydrochloride?
The canonical SMILES for 2-ethylquinazoline;hydrochloride is CCc1ncc2ccccc2n1.Cl.
What is the InChIKey of 2-ethylquinazoline;hydrochloride?
The InChIKey is YGHRDFJIWYCDIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.ClH/c1-2-10-11-7-8-5-3-4-6-9(8)12-10;/h3-7H,2H2,1H3;1H.
What are the key properties of 2-ethylquinazoline;hydrochloride?
2-ethylquinazoline;hydrochloride has a molecular weight of 194.67 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylquinazoline;hydrochloride is sourced from PubChem (CID 153374561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).