C34H34N4 — CID 153375013
acetylene;(E)-1-[(11Z)-8-methyl-13,20-dimethylidene-16,19,29-triazapentacyclo[21.3.1.16,9.114,18.02,7]nonacosa-1(26),2(7),3,5,8,11,14(28),15,17,23(27),24-undecaen-11-yl]prop-1-en-1-amine (PubChem CID 153375013) has the molecular formula C34H34N4 and a molecular weight of 498.67 g/mol. Its IUPAC name is acetylene;(E)-1-[(11Z)-8-methyl-13,20-dimethylidene-16,19,29-triazapentacyclo[21.3.1.16,9.114,18.02,7]nonacosa-1(26),2(7),3,5,8,11,14(28),15,17,23(27),24-undecaen-11-yl]prop-1-en-1-amine.
| Compound Name | acetylene;(E)-1-[(11Z)-8-methyl-13,20-dimethylidene-16,19,29-triazapentacyclo[21.3.1.16,9.114,18.02,7]nonacosa-1(26),2(7),3,5,8,11,14(28),15,17,23(27),24-undecaen-11-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 153375013 |
| Molecular Formula | C34H34N4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | acetylene;(E)-1-[(11Z)-8-methyl-13,20-dimethylidene-16,19,29-triazapentacyclo[21.3.1.16,9.114,18.02,7]nonacosa-1(26),2(7),3,5,8,11,14(28),15,17,23(27),24-undecaen-11-yl]prop-1-en-1-amine |
| SMILES | C#C.C=C1CCc2cccc(c2)-c2cccc3[nH]c(c(C)c23)CC(/C(N)=C\C)=C/C(=C)c2cncc(c2)N1 |
| InChI | InChI=1S/C32H32N4.C2H2/c1-5-29(33)25-14-20(2)26-16-27(19-34-18-26)35-21(3)12-13-23-8-6-9-24(15-23)28-10-7-11-30-32(28)22(4)31(17-25)36-30;1-2/h5-11,14-16,18-19,35-36H,2-3,12-13,17,33H2,1,4H3;1-2H/b25-14-,29-5+; |
| InChIKey | COAHHPBUMANJEG-WOHAYEGESA-N |
| XLogP | 7.70 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|