C28H27N5 — CID 153375034
21-methyl-8-methylidene-4,7,17,21-tetrazapentacyclo[21.3.1.12,6.110,14.115,19]triaconta-1(26),2(30),3,5,10,12,14(29),15,17,19(28),23(27),24-dodecaen-11-amine (PubChem CID 153375034) has the molecular formula C28H27N5 and a molecular weight of 433.56 g/mol. Its IUPAC name is 21-methyl-8-methylidene-4,7,17,21-tetrazapentacyclo[21.3.1.12,6.110,14.115,19]triaconta-1(26),2(30),3,5,10,12,14(29),15,17,19(28),23(27),24-dodecaen-11-amine.
| Compound Name | 21-methyl-8-methylidene-4,7,17,21-tetrazapentacyclo[21.3.1.12,6.110,14.115,19]triaconta-1(26),2(30),3,5,10,12,14(29),15,17,19(28),23(27),24-dodecaen-11-amine |
|---|---|
| PubChem CID | 153375034 |
| Molecular Formula | C28H27N5 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 21-methyl-8-methylidene-4,7,17,21-tetrazapentacyclo[21.3.1.12,6.110,14.115,19]triaconta-1(26),2(30),3,5,10,12,14(29),15,17,19(28),23(27),24-dodecaen-11-amine |
| SMILES | C=C1Cc2cc(ccc2N)-c2cncc(c2)CN(C)Cc2cccc(c2)-c2cncc(c2)N1 |
| InChI | InChI=1S/C28H27N5/c1-19-8-24-11-23(6-7-28(24)29)25-10-21(13-30-14-25)18-33(2)17-20-4-3-5-22(9-20)26-12-27(32-19)16-31-15-26/h3-7,9-16,32H,1,8,17-18,29H2,2H3 |
| InChIKey | CCZAPIGQIMBREH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|