About (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol
(2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol (PubChem CID 15337562) has the molecular formula C16H16F2N4O
and a molecular weight of 318.33 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol.
Molecular Properties
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol |
| PubChem CID | 15337562 |
| Molecular Formula | C16H16F2N4O |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol |
| SMILES | C[C@@H](n1cccn1)[C@](O)(Cn1ccnc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H16F2N4O/c1-12(22-7-2-5-20-22)16(23,10-21-8-6-19-11-21)14-4-3-13(17)9-15(14)18/h2-9,11-12,23H,10H2,1H3/t12-,16-/m1/s1 |
| InChIKey | FLYVJPDNOVOCOB-MLGOLLRUSA-N |
| XLogP | 2.51 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol?
The IUPAC name of (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol (CID 15337562) is (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol.
What is the SMILES notation for (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol?
The canonical SMILES for (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol is C[C@@H](n1cccn1)[C@](O)(Cn1ccnc1)c1ccc(F)cc1F.
What is the InChIKey of (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol?
The InChIKey is FLYVJPDNOVOCOB-MLGOLLRUSA-N. The full InChI is InChI=1S/C16H16F2N4O/c1-12(22-7-2-5-20-22)16(23,10-21-8-6-19-11-21)14-4-3-13(17)9-15(14)18/h2-9,11-12,23H,10H2,1H3/t12-,16-/m1/s1.
What are the key properties of (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol?
(2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol has a molecular weight of 318.33 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-(2,4-difluorophenyl)-1-imidazol-1-yl-3-pyrazol-1-ylbutan-2-ol is sourced from PubChem (CID 15337562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).