C27H24FN3O — CID 153375625
(5aR,6R,9aS)-2-benzyl-3-(3-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 153375625) has the molecular formula C27H24FN3O and a molecular weight of 425.51 g/mol. Its IUPAC name is (5aR,6R,9aS)-2-benzyl-3-(3-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-2-benzyl-3-(3-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 153375625 |
| Molecular Formula | C27H24FN3O |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (5aR,6R,9aS)-2-benzyl-3-(3-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(Cc4ccccc4)n(-c4cccc(F)c4)c3CC[C@H]12 |
| InChI | InChI=1S/C27H24FN3O/c1-17-22-11-12-23-26(27(22,2)15-19(16-29)25(17)32)30-24(13-18-7-4-3-5-8-18)31(23)21-10-6-9-20(28)14-21/h3-10,14-15,17,22H,11-13H2,1-2H3/t17-,22-,27-/m1/s1 |
| InChIKey | OVDHIMGJIXBIAC-UKPISFLSSA-N |
| XLogP | 5.09 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |