C31H24F2N4O — CID 153375637
(5aR,6R,9aS)-3-(3-fluorophenyl)-2-[3-(5-fluoro-3-pyridinyl)phenyl]-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 153375637) has the molecular formula C31H24F2N4O and a molecular weight of 506.56 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-(3-fluorophenyl)-2-[3-(5-fluoro-3-pyridinyl)phenyl]-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-3-(3-fluorophenyl)-2-[3-(5-fluoro-3-pyridinyl)phenyl]-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 153375637 |
| Molecular Formula | C31H24F2N4O |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (5aR,6R,9aS)-3-(3-fluorophenyl)-2-[3-(5-fluoro-3-pyridinyl)phenyl]-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4cccc(-c5cncc(F)c5)c4)n(-c4cccc(F)c4)c3CC[C@H]12 |
| InChI | InChI=1S/C31H24F2N4O/c1-18-26-9-10-27-29(31(26,2)14-22(15-34)28(18)38)36-30(37(27)25-8-4-7-23(32)13-25)20-6-3-5-19(11-20)21-12-24(33)17-35-16-21/h3-8,11-14,16-18,26H,9-10H2,1-2H3/t18-,26-,31-/m1/s1 |
| InChIKey | IPQKYJNAJZXTDC-ZALSCMSASA-N |
| XLogP | 6.37 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |