C28H25N7O2 — CID 153375639
(5aR,6R,9aS)-6,9a-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 153375639) has the molecular formula C28H25N7O2 and a molecular weight of 491.56 g/mol. Its IUPAC name is (5aR,6R,9aS)-6,9a-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-6,9a-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 153375639 |
| Molecular Formula | C28H25N7O2 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (5aR,6R,9aS)-6,9a-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | Cc1cc(-c2ccc(-n3nc(-c4nc(C)no4)c4c3[C@]3(C)C=C(C#N)C(=O)[C@H](C)[C@H]3CC4)cc2)cnn1 |
| InChI | InChI=1S/C28H25N7O2/c1-15-11-19(14-30-32-15)18-5-7-21(8-6-18)35-26-22(24(33-35)27-31-17(3)34-37-27)9-10-23-16(2)25(36)20(13-29)12-28(23,26)4/h5-8,11-12,14,16,23H,9-10H2,1-4H3/t16-,23-,28-/m1/s1 |
| InChIKey | BZTRUGRHWXMPIJ-HTNMQIFZSA-N |
| XLogP | 4.49 |
| TPSA | 123.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |