C28H25FN4O — CID 153375680
(5aR,6R,9aS)-2-(6-cyclopropyl-3-pyridinyl)-3-(3-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 153375680) has the molecular formula C28H25FN4O and a molecular weight of 452.53 g/mol. Its IUPAC name is (5aR,6R,9aS)-2-(6-cyclopropyl-3-pyridinyl)-3-(3-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-2-(6-cyclopropyl-3-pyridinyl)-3-(3-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 153375680 |
| Molecular Formula | C28H25FN4O |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (5aR,6R,9aS)-2-(6-cyclopropyl-3-pyridinyl)-3-(3-fluorophenyl)-6,9a-dimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4ccc(C5CC5)nc4)n(-c4cccc(F)c4)c3CC[C@H]12 |
| InChI | InChI=1S/C28H25FN4O/c1-16-22-9-11-24-26(28(22,2)13-19(14-30)25(16)34)32-27(33(24)21-5-3-4-20(29)12-21)18-8-10-23(31-15-18)17-6-7-17/h3-5,8,10,12-13,15-17,22H,6-7,9,11H2,1-2H3/t16-,22-,28-/m1/s1 |
| InChIKey | GJEDETDEHDLYFA-ZCRVEVSISA-N |
| XLogP | 5.44 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |