C31H28FN5O — CID 153375691
(5aR,6R,9aR)-3-(2-fluorophenyl)-6,9a-dimethyl-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 153375691) has the molecular formula C31H28FN5O and a molecular weight of 505.60 g/mol. Its IUPAC name is (5aR,6R,9aR)-3-(2-fluorophenyl)-6,9a-dimethyl-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aR)-3-(2-fluorophenyl)-6,9a-dimethyl-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 153375691 |
| Molecular Formula | C31H28FN5O |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (5aR,6R,9aR)-3-(2-fluorophenyl)-6,9a-dimethyl-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | Cc1cc(-c2ccc(-n3nc(-c4ccccc4F)c4c3[C@]3(C)CC(C#N)C(=O)[C@H](C)[C@H]3CC4)cc2)cnn1 |
| InChI | InChI=1S/C31H28FN5O/c1-18-14-21(17-34-35-18)20-8-10-23(11-9-20)37-30-25(28(36-37)24-6-4-5-7-27(24)32)12-13-26-19(2)29(38)22(16-33)15-31(26,30)3/h4-11,14,17,19,22,26H,12-13,15H2,1-3H3/t19-,22?,26-,31-/m1/s1 |
| InChIKey | MLWWWTGTLDOQKM-YTWAPNGQSA-N |
| XLogP | 6.01 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|