About (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate
(4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate (PubChem CID 153375909) has the molecular formula C17H28F2O3
and a molecular weight of 318.40 g/mol. Its IUPAC name is (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate |
| PubChem CID | 153375909 |
| Molecular Formula | C17H28F2O3 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate |
| SMILES | CCOC1C(C)CC(OC(=O)C2CCC(C)CC2)C(F)C1F |
| InChI | InChI=1S/C17H28F2O3/c1-4-21-16-11(3)9-13(14(18)15(16)19)22-17(20)12-7-5-10(2)6-8-12/h10-16H,4-9H2,1-3H3 |
| InChIKey | ANYCKIWVBFAPFR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate?
The IUPAC name of (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate (CID 153375909) is (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate.
What is the SMILES notation for (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate?
The canonical SMILES for (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate is CCOC1C(C)CC(OC(=O)C2CCC(C)CC2)C(F)C1F.
What is the InChIKey of (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate?
The InChIKey is ANYCKIWVBFAPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28F2O3/c1-4-21-16-11(3)9-13(14(18)15(16)19)22-17(20)12-7-5-10(2)6-8-12/h10-16H,4-9H2,1-3H3.
What are the key properties of (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate?
(4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate has a molecular weight of 318.40 g/mol, XLogP of 3.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxy-2,3-difluoro-5-methylcyclohexyl) 4-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 153375909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).