About 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium
6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium (PubChem CID 153376618) has the molecular formula C8H8FN2OS+
and a molecular weight of 199.23 g/mol. Its IUPAC name is 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium.
Molecular Properties
| Compound Name | 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium |
| PubChem CID | 153376618 |
| Molecular Formula | C8H8FN2OS+ |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium |
| SMILES | CO[n+]1cc(F)cc2sc(C)nc21 |
| InChI | InChI=1S/C8H8FN2OS/c1-5-10-8-7(13-5)3-6(9)4-11(8)12-2/h3-4H,1-2H3/q+1 |
| InChIKey | ROZZOGOYJXNXLA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium?
The IUPAC name of 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium (CID 153376618) is 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium.
What is the SMILES notation for 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium?
The canonical SMILES for 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium is CO[n+]1cc(F)cc2sc(C)nc21.
What is the InChIKey of 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium?
The InChIKey is ROZZOGOYJXNXLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN2OS/c1-5-10-8-7(13-5)3-6(9)4-11(8)12-2/h3-4H,1-2H3/q+1.
What are the key properties of 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium?
6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium has a molecular weight of 199.23 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4-methoxy-2-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium is sourced from PubChem (CID 153376618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).