C16H24N2O3S — CID 153376763
tert-butyl (3S)-3-[(2-methoxy-3-pyridinyl)-sulfanylmethyl]pyrrolidine-1-carboxylate (PubChem CID 153376763) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2-methoxy-3-pyridinyl)-sulfanylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(2-methoxy-3-pyridinyl)-sulfanylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 153376763 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl (3S)-3-[(2-methoxy-3-pyridinyl)-sulfanylmethyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ncccc1C(S)[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H24N2O3S/c1-16(2,3)21-15(19)18-9-7-11(10-18)13(22)12-6-5-8-17-14(12)20-4/h5-6,8,11,13,22H,7,9-10H2,1-4H3/t11-,13?/m0/s1 |
| InChIKey | QNZHQNNZIAZJMN-AMGKYWFPSA-N |
| XLogP | 3.32 |
| TPSA | 51.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|