About ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane
ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane (PubChem CID 153377233) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane.
Molecular Properties
| Compound Name | ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane |
| PubChem CID | 153377233 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane |
| SMILES | C=C/N=C(C=C)/C(C)=C\N.CC.CCC |
| InChI | InChI=1S/C8H12N2.C3H8.C2H6/c1-4-8(10-5-2)7(3)6-9;1-3-2;1-2/h4-6H,1-2,9H2,3H3;3H2,1-2H3;1-2H3/b7-6-,10-8+;; |
| InChIKey | SNXDMAPSTVYSJU-CTZBBKKDSA-N |
| XLogP | 4.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane?
The IUPAC name of ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane (CID 153377233) is ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane.
What is the SMILES notation for ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane?
The canonical SMILES for ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane is C=C/N=C(C=C)/C(C)=C\N.CC.CCC.
What is the InChIKey of ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane?
The InChIKey is SNXDMAPSTVYSJU-CTZBBKKDSA-N. The full InChI is InChI=1S/C8H12N2.C3H8.C2H6/c1-4-8(10-5-2)7(3)6-9;1-3-2;1-2/h4-6H,1-2,9H2,3H3;3H2,1-2H3;1-2H3/b7-6-,10-8+;;.
What are the key properties of ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane?
ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane has a molecular weight of 210.36 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1Z)-3-ethenylimino-2-methylpenta-1,4-dien-1-amine;propane is sourced from PubChem (CID 153377233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).