C14H23N3 — CID 153377588
(Z)-2-(2,4-dimethyl-1,2,3,6-tetrahydropyridin-5-yl)-3-(methylamino)hex-2-enenitrile (PubChem CID 153377588) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (Z)-2-(2,4-dimethyl-1,2,3,6-tetrahydropyridin-5-yl)-3-(methylamino)hex-2-enenitrile.
| Compound Name | (Z)-2-(2,4-dimethyl-1,2,3,6-tetrahydropyridin-5-yl)-3-(methylamino)hex-2-enenitrile |
|---|---|
| PubChem CID | 153377588 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (Z)-2-(2,4-dimethyl-1,2,3,6-tetrahydropyridin-5-yl)-3-(methylamino)hex-2-enenitrile |
| SMILES | CCC/C(NC)=C(/C#N)C1=C(C)CC(C)NC1 |
| InChI | InChI=1S/C14H23N3/c1-5-6-14(16-4)12(8-15)13-9-17-11(3)7-10(13)2/h11,16-17H,5-7,9H2,1-4H3/b14-12+ |
| InChIKey | YDKLWWJNLHRRBU-WYMLVPIESA-N |
| XLogP | 2.48 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|