About Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate
Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate (PubChem CID 15337768) has the molecular formula C18H17NO2Se
and a molecular weight of 358.30 g/mol. Its IUPAC name is Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate.
Molecular Properties
| Compound Name | Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate |
| PubChem CID | 15337768 |
| Molecular Formula | C18H17NO2Se |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate |
| SMILES | O=C([Se]c1ccccc1)C1CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H17NO2Se/c20-17-12-11-16(18(21)22-15-9-5-2-6-10-15)19(17)13-14-7-3-1-4-8-14/h1-10,16H,11-13H2 |
| InChIKey | JYBCNLWYGOSCQK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate?
The IUPAC name of Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate (CID 15337768) is Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate.
What is the SMILES notation for Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate?
The canonical SMILES for Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate is O=C([Se]c1ccccc1)C1CCC(=O)N1Cc1ccccc1.
What is the InChIKey of Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate?
The InChIKey is JYBCNLWYGOSCQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2Se/c20-17-12-11-16(18(21)22-15-9-5-2-6-10-15)19(17)13-14-7-3-1-4-8-14/h1-10,16H,11-13H2.
What are the key properties of Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate?
Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate has a molecular weight of 358.30 g/mol, XLogP of 1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Se-phenyl 1-benzyl-5-oxopyrrolidine-2-carboselenoate is sourced from PubChem (CID 15337768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).