About 1,4-bis(4-methylphenyl)pyrazole;methanamine
1,4-bis(4-methylphenyl)pyrazole;methanamine (PubChem CID 153378123) has the molecular formula C18H21N3
and a molecular weight of 279.39 g/mol. Its IUPAC name is 1,4-bis(4-methylphenyl)pyrazole;methanamine.
Molecular Properties
| Compound Name | 1,4-bis(4-methylphenyl)pyrazole;methanamine |
| PubChem CID | 153378123 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1,4-bis(4-methylphenyl)pyrazole;methanamine |
| SMILES | CN.Cc1ccc(-c2cnn(-c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C17H16N2.CH5N/c1-13-3-7-15(8-4-13)16-11-18-19(12-16)17-9-5-14(2)6-10-17;1-2/h3-12H,1-2H3;2H2,1H3 |
| InChIKey | TWBLPFFBUPAILU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-bis(4-methylphenyl)pyrazole;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(4-methylphenyl)pyrazole;methanamine?
The IUPAC name of 1,4-bis(4-methylphenyl)pyrazole;methanamine (CID 153378123) is 1,4-bis(4-methylphenyl)pyrazole;methanamine.
What is the SMILES notation for 1,4-bis(4-methylphenyl)pyrazole;methanamine?
The canonical SMILES for 1,4-bis(4-methylphenyl)pyrazole;methanamine is CN.Cc1ccc(-c2cnn(-c3ccc(C)cc3)c2)cc1.
What is the InChIKey of 1,4-bis(4-methylphenyl)pyrazole;methanamine?
The InChIKey is TWBLPFFBUPAILU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2.CH5N/c1-13-3-7-15(8-4-13)16-11-18-19(12-16)17-9-5-14(2)6-10-17;1-2/h3-12H,1-2H3;2H2,1H3.
What are the key properties of 1,4-bis(4-methylphenyl)pyrazole;methanamine?
1,4-bis(4-methylphenyl)pyrazole;methanamine has a molecular weight of 279.39 g/mol, XLogP of 3.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(4-methylphenyl)pyrazole;methanamine is sourced from PubChem (CID 153378123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).