C18H21N3 — CID 153378123
1,4-bis(4-methylphenyl)pyrazole;methanamine (PubChem CID 153378123) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 1,4-bis(4-methylphenyl)pyrazole;methanamine.
| Compound Name | 1,4-bis(4-methylphenyl)pyrazole;methanamine |
|---|---|
| PubChem CID | 153378123 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1,4-bis(4-methylphenyl)pyrazole;methanamine |
| SMILES | CN.Cc1ccc(-c2cnn(-c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C17H16N2.CH5N/c1-13-3-7-15(8-4-13)16-11-18-19(12-16)17-9-5-14(2)6-10-17;1-2/h3-12H,1-2H3;2H2,1H3 |
| InChIKey | TWBLPFFBUPAILU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |