About CID 153378305
CID 153378305 (PubChem CID 153378305) has the molecular formula C9H17BNO3
and a molecular weight of 198.05 g/mol.
Molecular Properties
| Compound Name | CID 153378305 |
| PubChem CID | 153378305 |
| Molecular Formula | C9H17BNO3 |
| Molecular Weight | 198.05 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | — |
| SMILES | N[C@@]1(C(=O)O)CCC[C@@H]1CCC[B]O |
| InChI | InChI=1S/C9H17BNO3/c11-9(8(12)13)5-1-3-7(9)4-2-6-10-14/h7,14H,1-6,11H2,(H,12,13)/t7-,9+/m1/s1 |
| InChIKey | JFWAFRDDTPEKSG-APPZFPTMSA-N |
| XLogP | 0.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.05 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153378305 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153378305?
The IUPAC name of CID 153378305 (CID 153378305) is not available.
What is the SMILES notation for CID 153378305?
The canonical SMILES for CID 153378305 is N[C@@]1(C(=O)O)CCC[C@@H]1CCC[B]O.
What is the InChIKey of CID 153378305?
The InChIKey is JFWAFRDDTPEKSG-APPZFPTMSA-N. The full InChI is InChI=1S/C9H17BNO3/c11-9(8(12)13)5-1-3-7(9)4-2-6-10-14/h7,14H,1-6,11H2,(H,12,13)/t7-,9+/m1/s1.
What are the key properties of CID 153378305?
CID 153378305 has a molecular weight of 198.05 g/mol, XLogP of 0.38, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153378305 is sourced from PubChem (CID 153378305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).