C14H26BN3O6 — CID 153378492
(3aR,4S,5S,6aR)-5-amino-2-[(2S)-2-amino-3-hydroxypropanoyl]-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid (PubChem CID 153378492) has the molecular formula C14H26BN3O6 and a molecular weight of 343.19 g/mol. Its IUPAC name is (3aR,4S,5S,6aR)-5-amino-2-[(2S)-2-amino-3-hydroxypropanoyl]-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,4S,5S,6aR)-5-amino-2-[(2S)-2-amino-3-hydroxypropanoyl]-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 153378492 |
| Molecular Formula | C14H26BN3O6 |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (3aR,4S,5S,6aR)-5-amino-2-[(2S)-2-amino-3-hydroxypropanoyl]-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
| SMILES | N[C@@H](CO)C(=O)N1C[C@@H]2C[C@@](N)(C(=O)O)[C@@H](CCCB(O)O)[C@@H]2C1 |
| InChI | InChI=1S/C14H26BN3O6/c16-11(7-19)12(20)18-5-8-4-14(17,13(21)22)10(9(8)6-18)2-1-3-15(23)24/h8-11,19,23-24H,1-7,16-17H2,(H,21,22)/t8-,9+,10-,11-,14-/m0/s1 |
| InChIKey | SGZZSAVGPOSWKD-KKSJPVRNSA-N |
| XLogP | -2.56 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|