C20H17ClN6O — CID 153378846
(5Z)-5-(aminomethylidene)-8-chloro-3-[2-(6-methoxy-3-pyridinyl)ethynyl]-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine (PubChem CID 153378846) has the molecular formula C20H17ClN6O and a molecular weight of 392.85 g/mol. Its IUPAC name is (5Z)-5-(aminomethylidene)-8-chloro-3-[2-(6-methoxy-3-pyridinyl)ethynyl]-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine.
| Compound Name | (5Z)-5-(aminomethylidene)-8-chloro-3-[2-(6-methoxy-3-pyridinyl)ethynyl]-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine |
|---|---|
| PubChem CID | 153378846 |
| Molecular Formula | C20H17ClN6O |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (5Z)-5-(aminomethylidene)-8-chloro-3-[2-(6-methoxy-3-pyridinyl)ethynyl]-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine |
| SMILES | COc1ccc(C#Cc2ncn3c2C/C(=C/N)N(N)c2cc(Cl)ccc2-3)cn1 |
| InChI | InChI=1S/C20H17ClN6O/c1-28-20-7-3-13(11-24-20)2-5-16-18-9-15(10-22)27(23)19-8-14(21)4-6-17(19)26(18)12-25-16/h3-4,6-8,10-12H,9,22-23H2,1H3/b15-10- |
| InChIKey | MOXSUAFRHYHGNQ-GDNBJRDFSA-N |
| XLogP | 2.37 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|