C28H35N5O7 — CID 153379374
diethyl 2-[3-[[6-amino-2-(1-hydroxyethyl)purin-9-yl]methyl]-2-methoxypent-4-ynoxy]-2-benzylpropanedioate (PubChem CID 153379374) has the molecular formula C28H35N5O7 and a molecular weight of 553.62 g/mol. Its IUPAC name is diethyl 2-[3-[[6-amino-2-(1-hydroxyethyl)purin-9-yl]methyl]-2-methoxypent-4-ynoxy]-2-benzylpropanedioate.
| Compound Name | diethyl 2-[3-[[6-amino-2-(1-hydroxyethyl)purin-9-yl]methyl]-2-methoxypent-4-ynoxy]-2-benzylpropanedioate |
|---|---|
| PubChem CID | 153379374 |
| Molecular Formula | C28H35N5O7 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | diethyl 2-[3-[[6-amino-2-(1-hydroxyethyl)purin-9-yl]methyl]-2-methoxypent-4-ynoxy]-2-benzylpropanedioate |
| SMILES | C#CC(Cn1cnc2c(N)nc(C(C)O)nc21)C(COC(Cc1ccccc1)(C(=O)OCC)C(=O)OCC)OC |
| InChI | InChI=1S/C28H35N5O7/c1-6-20(15-33-17-30-22-23(29)31-24(18(4)34)32-25(22)33)21(37-5)16-40-28(26(35)38-7-2,27(36)39-8-3)14-19-12-10-9-11-13-19/h1,9-13,17-18,20-21,34H,7-8,14-16H2,2-5H3,(H2,29,31,32) |
| InChIKey | JNYCCNAVHGEOPQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|