About ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol
ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol (PubChem CID 153379390) has the molecular formula C17H27NO6S
and a molecular weight of 373.47 g/mol. Its IUPAC name is ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol.
Molecular Properties
| Compound Name | ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol |
| PubChem CID | 153379390 |
| Molecular Formula | C17H27NO6S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol |
| SMILES | C#CCCOC(C)COC(C(=O)OCC)c1cscn1.CC(C)(O)O |
| InChI | InChI=1S/C14H19NO4S.C3H8O2/c1-4-6-7-18-11(3)8-19-13(14(16)17-5-2)12-9-20-10-15-12;1-3(2,4)5/h1,9-11,13H,5-8H2,2-3H3;4-5H,1-2H3 |
| InChIKey | MENVUHRGOZFHDV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol?
The IUPAC name of ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol (CID 153379390) is ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol.
What is the SMILES notation for ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol?
The canonical SMILES for ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol is C#CCCOC(C)COC(C(=O)OCC)c1cscn1.CC(C)(O)O.
What is the InChIKey of ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol?
The InChIKey is MENVUHRGOZFHDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4S.C3H8O2/c1-4-6-7-18-11(3)8-19-13(14(16)17-5-2)12-9-20-10-15-12;1-3(2,4)5/h1,9-11,13H,5-8H2,2-3H3;4-5H,1-2H3.
What are the key properties of ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol?
ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol has a molecular weight of 373.47 g/mol, XLogP of 1.90, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-but-3-ynoxypropoxy)-2-(1,3-thiazol-4-yl)acetate;propane-2,2-diol is sourced from PubChem (CID 153379390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).