C31H39ClN6O8 — CID 153379399
diethyl 2-[(4-aminophenyl)methyl]-2-[3-[[2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]methyl]-2-methoxypent-4-ynoxy]propanedioate (PubChem CID 153379399) has the molecular formula C31H39ClN6O8 and a molecular weight of 659.14 g/mol. Its IUPAC name is diethyl 2-[(4-aminophenyl)methyl]-2-[3-[[2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]methyl]-2-methoxypent-4-ynoxy]propanedioate.
| Compound Name | diethyl 2-[(4-aminophenyl)methyl]-2-[3-[[2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]methyl]-2-methoxypent-4-ynoxy]propanedioate |
|---|---|
| PubChem CID | 153379399 |
| Molecular Formula | C31H39ClN6O8 |
| Molecular Weight | 659.14 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | diethyl 2-[(4-aminophenyl)methyl]-2-[3-[[2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]methyl]-2-methoxypent-4-ynoxy]propanedioate |
| SMILES | C#CC(Cn1cnc2c(NC(=O)OC(C)(C)C)nc(Cl)nc21)C(COC(Cc1ccc(N)cc1)(C(=O)OCC)C(=O)OCC)OC |
| InChI | InChI=1S/C31H39ClN6O8/c1-8-20(16-38-18-34-23-24(35-28(32)37-25(23)38)36-29(41)46-30(4,5)6)22(42-7)17-45-31(26(39)43-9-2,27(40)44-10-3)15-19-11-13-21(33)14-12-19/h1,11-14,18,20,22H,9-10,15-17,33H2,2-7H3,(H,35,36,37,41) |
| InChIKey | ZEDUKWBJOLURQJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 179.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|