About ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid
ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid (PubChem CID 153379462) has the molecular formula C11H15NO3S
and a molecular weight of 241.31 g/mol. Its IUPAC name is ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid.
Molecular Properties
| Compound Name | ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid |
| PubChem CID | 153379462 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid |
| SMILES | C#CCC(OC)(C(=O)O)c1cscn1.CC |
| InChI | InChI=1S/C9H9NO3S.C2H6/c1-3-4-9(13-2,8(11)12)7-5-14-6-10-7;1-2/h1,5-6H,4H2,2H3,(H,11,12);1-2H3 |
| InChIKey | PLTNPIYIJZPCEU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid?
The IUPAC name of ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid (CID 153379462) is ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid.
What is the SMILES notation for ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid?
The canonical SMILES for ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid is C#CCC(OC)(C(=O)O)c1cscn1.CC.
What is the InChIKey of ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid?
The InChIKey is PLTNPIYIJZPCEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3S.C2H6/c1-3-4-9(13-2,8(11)12)7-5-14-6-10-7;1-2/h1,5-6H,4H2,2H3,(H,11,12);1-2H3.
What are the key properties of ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid?
ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid has a molecular weight of 241.31 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-2-(1,3-thiazol-4-yl)pent-4-ynoic acid is sourced from PubChem (CID 153379462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).