About diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol
diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol (PubChem CID 153379525) has the molecular formula C24H36O8
and a molecular weight of 452.54 g/mol. Its IUPAC name is diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol.
Molecular Properties
| Compound Name | diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol |
| PubChem CID | 153379525 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol |
| SMILES | C#CCCOC(C)COC(Cc1ccccc1)(C(=O)OCC)C(=O)OCC.CC(C)(O)O |
| InChI | InChI=1S/C21H28O6.C3H8O2/c1-5-8-14-26-17(4)16-27-21(19(22)24-6-2,20(23)25-7-3)15-18-12-10-9-11-13-18;1-3(2,4)5/h1,9-13,17H,6-8,14-16H2,2-4H3;4-5H,1-2H3 |
| InChIKey | HCTXHVLTWHBSTR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol?
The IUPAC name of diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol (CID 153379525) is diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol.
What is the SMILES notation for diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol?
The canonical SMILES for diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol is C#CCCOC(C)COC(Cc1ccccc1)(C(=O)OCC)C(=O)OCC.CC(C)(O)O.
What is the InChIKey of diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol?
The InChIKey is HCTXHVLTWHBSTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O6.C3H8O2/c1-5-8-14-26-17(4)16-27-21(19(22)24-6-2,20(23)25-7-3)15-18-12-10-9-11-13-18;1-3(2,4)5/h1,9-13,17H,6-8,14-16H2,2-4H3;4-5H,1-2H3.
What are the key properties of diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol?
diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol has a molecular weight of 452.54 g/mol, XLogP of 2.25, 12 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-benzyl-2-(2-but-3-ynoxypropoxy)propanedioate;propane-2,2-diol is sourced from PubChem (CID 153379525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).