About tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium
tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium (PubChem CID 153379751) has the molecular formula C20H26N3O5Y-
and a molecular weight of 477.35 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium.
Molecular Properties
| Compound Name | tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium |
| PubChem CID | 153379751 |
| Molecular Formula | C20H26N3O5Y- |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium |
| SMILES | COc1cnn(CCO)c(=O)c1-c1ccc(C[CH-]NC(=O)OC(C)(C)C)cc1.[Y] |
| InChI | InChI=1S/C20H26N3O5.Y/c1-20(2,3)28-19(26)21-10-9-14-5-7-15(8-6-14)17-16(27-4)13-22-23(11-12-24)18(17)25;/h5-8,10,13,24H,9,11-12H2,1-4H3,(H,21,26);/q-1; |
| InChIKey | FQUIEBRTIFERDS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium?
The IUPAC name of tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium (CID 153379751) is tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium.
What is the SMILES notation for tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium?
The canonical SMILES for tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium is COc1cnn(CCO)c(=O)c1-c1ccc(C[CH-]NC(=O)OC(C)(C)C)cc1.[Y].
What is the InChIKey of tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium?
The InChIKey is FQUIEBRTIFERDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N3O5.Y/c1-20(2,3)28-19(26)21-10-9-14-5-7-15(8-6-14)17-16(27-4)13-22-23(11-12-24)18(17)25;/h5-8,10,13,24H,9,11-12H2,1-4H3,(H,21,26);/q-1;.
What are the key properties of tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium?
tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium has a molecular weight of 477.35 g/mol, XLogP of 2.14, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[4-[2-(2-hydroxyethyl)-5-methoxy-3-oxopyridazin-4-yl]phenyl]ethyl]carbamate;yttrium is sourced from PubChem (CID 153379751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).