C33H29FN4O — CID 153379786
(5aR,6R,9aS)-3-(3-fluorophenyl)-9a-methyl-7-oxo-6-propyl-2-(3-pyridin-4-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 153379786) has the molecular formula C33H29FN4O and a molecular weight of 516.62 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-(3-fluorophenyl)-9a-methyl-7-oxo-6-propyl-2-(3-pyridin-4-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-3-(3-fluorophenyl)-9a-methyl-7-oxo-6-propyl-2-(3-pyridin-4-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 153379786 |
| Molecular Formula | C33H29FN4O |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | (5aR,6R,9aS)-3-(3-fluorophenyl)-9a-methyl-7-oxo-6-propyl-2-(3-pyridin-4-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | CCC[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4cccc(-c5ccncc5)c4)n(-c4cccc(F)c4)c3CC[C@H]12 |
| InChI | InChI=1S/C33H29FN4O/c1-3-6-27-28-11-12-29-31(33(28,2)19-24(20-35)30(27)39)37-32(38(29)26-10-5-9-25(34)18-26)23-8-4-7-22(17-23)21-13-15-36-16-14-21/h4-5,7-10,13-19,27-28H,3,6,11-12H2,1-2H3/t27-,28-,33-/m1/s1 |
| InChIKey | ZIFVNMBZPHSLOY-AZWXHJKFSA-N |
| XLogP | 7.01 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |