C28H20F4N4OS — CID 153379799
(5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 153379799) has the molecular formula C28H20F4N4OS and a molecular weight of 536.55 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 153379799 |
| Molecular Formula | C28H20F4N4OS |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-7-oxo-1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3c(c(-c4ccccc4F)nn3-c3nc4cc(C(F)(F)F)ccc4s3)CC[C@H]12 |
| InChI | InChI=1S/C28H20F4N4OS/c1-14-19-9-8-18-23(17-5-3-4-6-20(17)29)35-36(25(18)27(19,2)12-15(13-33)24(14)37)26-34-21-11-16(28(30,31)32)7-10-22(21)38-26/h3-7,10-12,14,19H,8-9H2,1-2H3/t14-,19-,27-/m1/s1 |
| InChIKey | DZYDAWPJYPHMKQ-FHNDPDEWSA-N |
| XLogP | 6.80 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |