C28H22FN5O2 — CID 153379808
3-(4-fluorophenyl)-6-methyl-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-7-oxo-5,5a,6,9a-tetrahydro-4H-benzo[g]indazole-8-carbonitrile (PubChem CID 153379808) has the molecular formula C28H22FN5O2 and a molecular weight of 479.52 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6-methyl-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-7-oxo-5,5a,6,9a-tetrahydro-4H-benzo[g]indazole-8-carbonitrile.
| Compound Name | 3-(4-fluorophenyl)-6-methyl-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-7-oxo-5,5a,6,9a-tetrahydro-4H-benzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 153379808 |
| Molecular Formula | C28H22FN5O2 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 3-(4-fluorophenyl)-6-methyl-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-7-oxo-5,5a,6,9a-tetrahydro-4H-benzo[g]indazole-8-carbonitrile |
| SMILES | Cc1nc(-c2ccc(-n3nc(-c4ccc(F)cc4)c4c3C3C=C(C#N)C(=O)C(C)C3CC4)cc2)no1 |
| InChI | InChI=1S/C28H22FN5O2/c1-15-22-11-12-23-25(17-3-7-20(29)8-4-17)32-34(26(23)24(22)13-19(14-30)27(15)35)21-9-5-18(6-10-21)28-31-16(2)36-33-28/h3-10,13,15,22,24H,11-12H2,1-2H3 |
| InChIKey | GSTSYRGECDCZEM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 97.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |