C32H35N3O2 — CID 153379860
(5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-(2-phenylmethoxyethyl)-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 153379860) has the molecular formula C32H35N3O2 and a molecular weight of 493.65 g/mol. Its IUPAC name is (5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-(2-phenylmethoxyethyl)-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-(2-phenylmethoxyethyl)-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 153379860 |
| Molecular Formula | C32H35N3O2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | (5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-(2-phenylmethoxyethyl)-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | CC(C)c1ccc(-c2nc3c(n2CCOCc2ccccc2)CC[C@@H]2[C@@H](C)C(=O)C(C#N)=C[C@@]32C)cc1 |
| InChI | InChI=1S/C32H35N3O2/c1-21(2)24-10-12-25(13-11-24)31-34-30-28(35(31)16-17-37-20-23-8-6-5-7-9-23)15-14-27-22(3)29(36)26(19-33)18-32(27,30)4/h5-13,18,21-22,27H,14-17,20H2,1-4H3/t22-,27-,32-/m1/s1 |
| InChIKey | RFSCCSNHBHZTIT-ZGJWRPMSSA-N |
| XLogP | 6.38 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|