C17H18FN3O6S — CID 153379955
4-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxy-N-methylbutanamide (PubChem CID 153379955) has the molecular formula C17H18FN3O6S and a molecular weight of 411.41 g/mol. Its IUPAC name is 4-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxy-N-methylbutanamide.
| Compound Name | 4-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxy-N-methylbutanamide |
|---|---|
| PubChem CID | 153379955 |
| Molecular Formula | C17H18FN3O6S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxy-N-methylbutanamide |
| SMILES | CNC(=O)CCCOc1ccc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2c1 |
| InChI | InChI=1S/C17H18FN3O6S/c1-19-14(23)3-2-6-27-11-5-4-10-7-13(22)17(16(18)12(10)8-11)21-9-15(24)20-28(21,25)26/h4-5,7-8,22H,2-3,6,9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | ASGVCQPRSONHHR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|