C25H16F5NO3 — CID 153380423
2-[4-(4-methoxyphenyl)phenyl]-6-(1,1,2,2,2-pentafluoroethyl)quinoline-4-carboxylic acid (PubChem CID 153380423) has the molecular formula C25H16F5NO3 and a molecular weight of 473.40 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)phenyl]-6-(1,1,2,2,2-pentafluoroethyl)quinoline-4-carboxylic acid.
| Compound Name | 2-[4-(4-methoxyphenyl)phenyl]-6-(1,1,2,2,2-pentafluoroethyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 153380423 |
| Molecular Formula | C25H16F5NO3 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)phenyl]-6-(1,1,2,2,2-pentafluoroethyl)quinoline-4-carboxylic acid |
| SMILES | COc1ccc(-c2ccc(-c3cc(C(=O)O)c4cc(C(F)(F)C(F)(F)F)ccc4n3)cc2)cc1 |
| InChI | InChI=1S/C25H16F5NO3/c1-34-18-9-6-15(7-10-18)14-2-4-16(5-3-14)22-13-20(23(32)33)19-12-17(8-11-21(19)31-22)24(26,27)25(28,29)30/h2-13H,1H3,(H,32,33) |
| InChIKey | CCUKQXHBRLHIAR-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|