C15H27NO3 — CID 153380633
3-tert-butyl-2-methoxy-1-methyl-2H-pyrrol-5-one;2,2-dimethylpropanal (PubChem CID 153380633) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is 3-tert-butyl-2-methoxy-1-methyl-2H-pyrrol-5-one;2,2-dimethylpropanal.
| Compound Name | 3-tert-butyl-2-methoxy-1-methyl-2H-pyrrol-5-one;2,2-dimethylpropanal |
|---|---|
| PubChem CID | 153380633 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 3-tert-butyl-2-methoxy-1-methyl-2H-pyrrol-5-one;2,2-dimethylpropanal |
| SMILES | CC(C)(C)C=O.COC1C(C(C)(C)C)=CC(=O)N1C |
| InChI | InChI=1S/C10H17NO2.C5H10O/c1-10(2,3)7-6-8(12)11(4)9(7)13-5;1-5(2,3)4-6/h6,9H,1-5H3;4H,1-3H3 |
| InChIKey | WYFGXBHRNUCFBU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|