About 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one
2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one (PubChem CID 153380634) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one |
| PubChem CID | 153380634 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one |
| SMILES | CC(C)(C)C=O.COC1C(C(C)C)=CC(=O)N1C |
| InChI | InChI=1S/C9H15NO2.C5H10O/c1-6(2)7-5-8(11)10(3)9(7)12-4;1-5(2,3)4-6/h5-6,9H,1-4H3;4H,1-3H3 |
| InChIKey | OQQRYOVETTYPEH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one?
The IUPAC name of 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one (CID 153380634) is 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one.
What is the SMILES notation for 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one?
The canonical SMILES for 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one is CC(C)(C)C=O.COC1C(C(C)C)=CC(=O)N1C.
What is the InChIKey of 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one?
The InChIKey is OQQRYOVETTYPEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.C5H10O/c1-6(2)7-5-8(11)10(3)9(7)12-4;1-5(2,3)4-6/h5-6,9H,1-4H3;4H,1-3H3.
What are the key properties of 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one?
2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one has a molecular weight of 255.36 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanal;2-methoxy-1-methyl-3-propan-2-yl-2H-pyrrol-5-one is sourced from PubChem (CID 153380634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).