C13H23NO3 — CID 153380642
2,2-dimethylpropanal;3-ethyl-2-methoxy-1-methyl-2H-pyrrol-5-one (PubChem CID 153380642) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2,2-dimethylpropanal;3-ethyl-2-methoxy-1-methyl-2H-pyrrol-5-one.
| Compound Name | 2,2-dimethylpropanal;3-ethyl-2-methoxy-1-methyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 153380642 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2,2-dimethylpropanal;3-ethyl-2-methoxy-1-methyl-2H-pyrrol-5-one |
| SMILES | CC(C)(C)C=O.CCC1=CC(=O)N(C)C1OC |
| InChI | InChI=1S/C8H13NO2.C5H10O/c1-4-6-5-7(10)9(2)8(6)11-3;1-5(2,3)4-6/h5,8H,4H2,1-3H3;4H,1-3H3 |
| InChIKey | AWQVYACFUZQIRR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|