About 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane
2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane (PubChem CID 153380725) has the molecular formula C15H29BrO2
and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane.
Molecular Properties
| Compound Name | 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane |
| PubChem CID | 153380725 |
| Molecular Formula | C15H29BrO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane |
| SMILES | CC(=O)C(Br)C(=O)C1CC1.CCC.CCCCC |
| InChI | InChI=1S/C7H9BrO2.C5H12.C3H8/c1-4(9)6(8)7(10)5-2-3-5;1-3-5-4-2;1-3-2/h5-6H,2-3H2,1H3;3-5H2,1-2H3;3H2,1-2H3 |
| InChIKey | ZMCLKUYFKJTJDG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane?
The IUPAC name of 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane (CID 153380725) is 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane.
What is the SMILES notation for 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane?
The canonical SMILES for 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane is CC(=O)C(Br)C(=O)C1CC1.CCC.CCCCC.
What is the InChIKey of 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane?
The InChIKey is ZMCLKUYFKJTJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrO2.C5H12.C3H8/c1-4(9)6(8)7(10)5-2-3-5;1-3-5-4-2;1-3-2/h5-6H,2-3H2,1H3;3-5H2,1-2H3;3H2,1-2H3.
What are the key properties of 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane?
2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane has a molecular weight of 321.30 g/mol, XLogP of 4.93, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-cyclopropylbutane-1,3-dione;pentane;propane is sourced from PubChem (CID 153380725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).