C21H18N8O — CID 153381328
2-(furan-2-yl)-5-N-[2-(4-pyridin-4-ylphenyl)ethyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 153381328) has the molecular formula C21H18N8O and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-N-[2-(4-pyridin-4-ylphenyl)ethyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-5-N-[2-(4-pyridin-4-ylphenyl)ethyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 153381328 |
| Molecular Formula | C21H18N8O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-(furan-2-yl)-5-N-[2-(4-pyridin-4-ylphenyl)ethyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | Nc1nc(NCCc2ccc(-c3ccncc3)cc2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C21H18N8O/c22-19-26-20(27-21-25-18(28-29(19)21)17-2-1-13-30-17)24-12-7-14-3-5-15(6-4-14)16-8-10-23-11-9-16/h1-6,8-11,13H,7,12H2,(H3,22,24,25,26,27,28) |
| InChIKey | WUYYMPAEJVRYMH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |