C23H23N11O — CID 153381339
4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]-N'-(pyridin-4-ylmethylamino)benzenecarboximidamide (PubChem CID 153381339) has the molecular formula C23H23N11O and a molecular weight of 469.51 g/mol. Its IUPAC name is 4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]-N'-(pyridin-4-ylmethylamino)benzenecarboximidamide.
| Compound Name | 4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]-N'-(pyridin-4-ylmethylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 153381339 |
| Molecular Formula | C23H23N11O |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]-N'-(pyridin-4-ylmethylamino)benzenecarboximidamide |
| SMILES | N/C(=N\NCc1ccncc1)c1ccc(CCNc2nc(N)n3nc(-c4ccco4)nc3n2)cc1 |
| InChI | InChI=1S/C23H23N11O/c24-19(32-28-14-16-7-10-26-11-8-16)17-5-3-15(4-6-17)9-12-27-22-30-21(25)34-23(31-22)29-20(33-34)18-2-1-13-35-18/h1-8,10-11,13,28H,9,12,14H2,(H2,24,32)(H3,25,27,29,30,31,33) |
| InChIKey | XGNVGYLFSXKKBN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|