C34H43N3O5 — CID 153381606
(2S)-2-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methyl-5-[5-(2-phenoxyethoxy)-2-pyridinyl]-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 153381606) has the molecular formula C34H43N3O5 and a molecular weight of 573.73 g/mol. Its IUPAC name is (2S)-2-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methyl-5-[5-(2-phenoxyethoxy)-2-pyridinyl]-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | (2S)-2-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methyl-5-[5-(2-phenoxyethoxy)-2-pyridinyl]-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 153381606 |
| Molecular Formula | C34H43N3O5 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | (2S)-2-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methyl-5-[5-(2-phenoxyethoxy)-2-pyridinyl]-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1ncc(-c2ccc(OCCOc3ccccc3)cn2)c(N2CCC3CCCCC3C2)c1[C@H](OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C34H43N3O5/c1-23-30(32(33(38)39)42-34(2,3)4)31(37-17-16-24-10-8-9-11-25(24)22-37)28(21-35-23)29-15-14-27(20-36-29)41-19-18-40-26-12-6-5-7-13-26/h5-7,12-15,20-21,24-25,32H,8-11,16-19,22H2,1-4H3,(H,38,39)/t24?,25?,32-/m0/s1 |
| InChIKey | PHXMKXSWMIQNJS-ZPBULCBRSA-N |
| XLogP | 6.87 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|